CAS 2041072-41-5 appears in our catalog under these names: ICCB280, ICCB280/ 98.96% (existing batch purity), ICCB280 98%, (E)-2-(3,4-Dihydroxystyryl)-3-(2-methoxyphenyl)quinazolin-4(3H)-one, 97%, 97%, ICCB280, 98.14%. Offered by: GLPBio, TargetMol, Ambeed, Chemat, MedChemExpress. Available pack sizes: 5mg, 10mg, 100mg, 10mM (in 1ml dmso), 25mg, 50mg, 1mg, 2mg.
2-[(E)-2-(3,4-dihydroxyphenyl)ethenyl]-3-(2-methoxyphenyl)quinazolin-4-one (CAS 2041072-41-5) is a chemical compound with the molecular formula C23H18N2O4 and a molecular weight of 386.4 g/mol. IUPAC name: 2-[(E)-2-(3,4-dihydroxyphenyl)ethenyl]-3-(2-methoxyphenyl)quinazolin-4-one. InChIKey: OTKDKQJFWIGZLU-ACCUITESSA-N.
| Molecular formula | C23H18N2O4 |
|---|---|
| Molecular weight | 386.4 g/mol |
| IUPAC name | 2-[(E)-2-(3,4-dihydroxyphenyl)ethenyl]-3-(2-methoxyphenyl)quinazolin-4-one |
| InChIKey | OTKDKQJFWIGZLU-ACCUITESSA-N |
| SMILES | COC1=CC=CC=C1N2C(=NC3=CC=CC=C3C2=O)/C=C/C4=CC(=C(C=C4)O)O |
Computed by PubChem (NCBI)