CAS 1160927-48-9 appears in our catalog under these names: IDE1, 98+%, IDE1/ 98.36% (existing batch purity), IDE 1, IDE 1, IDE1 98+%. Offered by: AmBeed, TargetMol, GLPBio, Biosynth, Chemat. Available pack sizes: 250mg, 5g, 1g, 1mg, 2mg, 5mg, 10mg, 25mg.
2-[(E)-(6-carboxyhexanoylhydrazinylidene)methyl]benzoic acid (CAS 1160927-48-9) is a chemical compound with the molecular formula C15H18N2O5 and a molecular weight of 306.31 g/mol. IUPAC name: 2-[(E)-(6-carboxyhexanoylhydrazinylidene)methyl]benzoic acid. InChIKey: ABKJCDILEUEJSH-MHWRWJLKSA-N.
| Molecular formula | C15H18N2O5 |
|---|---|
| Molecular weight | 306.31 g/mol |
| IUPAC name | 2-[(E)-(6-carboxyhexanoylhydrazinylidene)methyl]benzoic acid |
| InChIKey | ABKJCDILEUEJSH-MHWRWJLKSA-N |
| SMILES | C1=CC=C(C(=C1)/C=N/NC(=O)CCCCCC(=O)O)C(=O)O |
Computed by PubChem (NCBI)