CAS 1431303-72-8 appears in our catalog under these names: Iadademstat dihydrochloride/ 98%, ORY-1001(trans), Iadademstat 2HCl 98%, trans-N1-((1R,2S)-2-Phenylcyclopropyl)cyclohexane-1,4-diamine dihydrochloride, 98%, 98%, Iadademstat (dihydrochloride), 99.98%. Offered by: TargetMol, Biosynth, Ambeed, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg, 1g.
4-N-[(1R,2S)-2-phenylcyclopropyl]cyclohexane-1,4-diamine;dihydrochloride (CAS 1431303-72-8) is a chemical compound with the molecular formula C15H24Cl2N2 and a molecular weight of 303.3 g/mol. IUPAC name: 4-N-[(1R,2S)-2-phenylcyclopropyl]cyclohexane-1,4-diamine;dihydrochloride. InChIKey: UCINOBZMLCREGM-RNNUGBGQSA-N.
| Molecular formula | C15H24Cl2N2 |
|---|---|
| Molecular weight | 303.3 g/mol |
| IUPAC name | 4-N-[(1R,2S)-2-phenylcyclopropyl]cyclohexane-1,4-diamine;dihydrochloride |
| InChIKey | UCINOBZMLCREGM-RNNUGBGQSA-N |
| SMILES | C1CC(CCC1N)N[C@@H]2C[C@H]2C3=CC=CC=C3.Cl.Cl |
Computed by PubChem (NCBI)