cas: 610798-31-7 — see every product listed under this CAS number, including other names
Icotinib, 99%, 99% (CAS 610798-31-7) is a chemical reagent available from Chemat. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 250mg, 1g, 1mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11ECDT-5mg |
| cas | 610798-31-7 |
| size | 5mg |
| availability | 3g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 5mg | 400.40 Pln | |
| Chemat | 10mg | 467.60 Pln | |
| Chemat | 25mg | 544.40 Pln | |
| Chemat | 50mg | 885.20 Pln | |
| Chemat | 100mg | 1461.20 Pln | |
| Chemat | 250mg | 2718.80 Pln | |
| Chemat | 1g | 7240.40 Pln | |
| Chemat | 1mg | 194.00 Pln |
| purity | 99% |
|---|---|
| delivery time | 3 weeks |
N-(3-ethynylphenyl)-2,5,8,11-tetraoxa-15,17-diazatricyclo[10.8.0.014,19]icosa-1(12),13,15,17,19-pentaen-18-amine (CAS 610798-31-7) is a chemical compound with the molecular formula C22H21N3O4 and a molecular weight of 391.4 g/mol. IUPAC name: N-(3-ethynylphenyl)-2,5,8,11-tetraoxa-15,17-diazatricyclo[10.8.0.014,19]icosa-1(12),13,15,17,19-pentaen-18-amine. InChIKey: QQLKULDARVNMAL-UHFFFAOYSA-N.
| Molecular formula | C22H21N3O4 |
|---|---|
| Molecular weight | 391.4 g/mol |
| IUPAC name | N-(3-ethynylphenyl)-2,5,8,11-tetraoxa-15,17-diazatricyclo[10.8.0.014,19]icosa-1(12),13,15,17,19-pentaen-18-amine |
| InChIKey | QQLKULDARVNMAL-UHFFFAOYSA-N |
| SMILES | C#CC1=CC(=CC=C1)NC2=NC=NC3=CC4=C(C=C32)OCCOCCOCCO4 |
Computed by PubChem (NCBI)