CAS 610798-31-7 appears in our catalog under these names: Icotinib, 98+%, Icotinib/ 99.79% (existing batch purity), Icotinib, Icotinib, 99%, 99%, Icotinib, 99.96%. Offered by: AmBeed, TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 10mg, 1mg, 2mg, 5mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso).
N-(3-ethynylphenyl)-2,5,8,11-tetraoxa-15,17-diazatricyclo[10.8.0.014,19]icosa-1(12),13,15,17,19-pentaen-18-amine (CAS 610798-31-7) is a chemical compound with the molecular formula C22H21N3O4 and a molecular weight of 391.4 g/mol. IUPAC name: N-(3-ethynylphenyl)-2,5,8,11-tetraoxa-15,17-diazatricyclo[10.8.0.014,19]icosa-1(12),13,15,17,19-pentaen-18-amine. InChIKey: QQLKULDARVNMAL-UHFFFAOYSA-N.
| Molecular formula | C22H21N3O4 |
|---|---|
| Molecular weight | 391.4 g/mol |
| IUPAC name | N-(3-ethynylphenyl)-2,5,8,11-tetraoxa-15,17-diazatricyclo[10.8.0.014,19]icosa-1(12),13,15,17,19-pentaen-18-amine |
| InChIKey | QQLKULDARVNMAL-UHFFFAOYSA-N |
| SMILES | C#CC1=CC(=CC=C1)NC2=NC=NC3=CC4=C(C=C32)OCCOCCOCCO4 |
Computed by PubChem (NCBI)