Products 1998640-22-4
CAS 1998640-22-4 is the registry number for (S)-2-N-Fmoc-3-(1-methyl-1H-pyrazol-3-yl)-Ala-OH, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(1-methylpyrazol-3-yl)propanoic acid (CAS 1998640-22-4) is a chemical compound with the molecular formula C22H21N3O4 and a molecular weight of 391.4 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(1-methylpyrazol-3-yl)propanoic acid. InChIKey: PUOKICYUJODHDF-FQEVSTJZSA-N.
| Molecular formula | C22H21N3O4 |
|---|---|
| Molecular weight | 391.4 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(1-methylpyrazol-3-yl)propanoic acid |
| InChIKey | PUOKICYUJODHDF-FQEVSTJZSA-N |
| SMILES | CN1C=CC(=N1)C[C@@H](C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)