cas: 479028-72-3 — see every product listed under this CAS number, including other names
Imidazo[1,2-a]pyridine-5-carboxylic acid, 95% (CAS 479028-72-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 2.5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F227854-100MG |
| cas | 479028-72-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 185.37 Pln | |
| Fluorochem | 250mg | 258.26 Pln | |
| Fluorochem | 1g | 497.76 Pln | |
| Fluorochem | 2.5g | 1138.16 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
Imidazo[1,2-a]pyridine-5-carboxylic acid (CAS 479028-72-3) is a chemical compound with the molecular formula C8H6N2O2 and a molecular weight of 162.15 g/mol. IUPAC name: imidazo[1,2-a]pyridine-5-carboxylic acid. InChIKey: IAXRYEXXAPLEGT-UHFFFAOYSA-N.
| Molecular formula | C8H6N2O2 |
|---|---|
| Molecular weight | 162.15 g/mol |
| IUPAC name | imidazo[1,2-a]pyridine-5-carboxylic acid |
| InChIKey | IAXRYEXXAPLEGT-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC=CN2C(=C1)C(=O)O |
Computed by PubChem (NCBI)