cas: 885276-19-7 — see every product listed under this CAS number, including other names
Imidazo[1,5-a]pyridine-5-carboxylic acid, 97%, 97% (CAS 885276-19-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11H45D-100mg |
| cas | 885276-19-7 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 1053.20 Pln | |
| Chemat | 250mg | 1202.00 Pln | |
| Chemat | 1g | 2339.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Imidazo[1,5-a]pyridine-5-carboxylic acid (CAS 885276-19-7) is a chemical compound with the molecular formula C8H6N2O2 and a molecular weight of 162.15 g/mol. IUPAC name: imidazo[1,5-a]pyridine-5-carboxylic acid. InChIKey: AWWQOKTUOLEQGD-UHFFFAOYSA-N.
| Molecular formula | C8H6N2O2 |
|---|---|
| Molecular weight | 162.15 g/mol |
| IUPAC name | imidazo[1,5-a]pyridine-5-carboxylic acid |
| InChIKey | AWWQOKTUOLEQGD-UHFFFAOYSA-N |
| SMILES | C1=CC2=CN=CN2C(=C1)C(=O)O |
Computed by PubChem (NCBI)