CAS 848142-62-1 appears in our catalog under these names: Indazole–Cl, Indazole-Cl/ 98.72% (existing batch purity), 3-chloro-2-(4-hydroxyphenyl)-2H-indazol-5-ol, Indazole-Cl, 98.72%. Offered by: GLPBio, TargetMol, Chemat, MedChemExpress. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg.
3-chloro-2-(4-hydroxyphenyl)indazol-5-ol (CAS 848142-62-1) is a chemical compound with the molecular formula C13H9ClN2O2 and a molecular weight of 260.67 g/mol. IUPAC name: 3-chloro-2-(4-hydroxyphenyl)indazol-5-ol. InChIKey: ZNHQDSBJVFFIAK-UHFFFAOYSA-N.
| Molecular formula | C13H9ClN2O2 |
|---|---|
| Molecular weight | 260.67 g/mol |
| IUPAC name | 3-chloro-2-(4-hydroxyphenyl)indazol-5-ol |
| InChIKey | ZNHQDSBJVFFIAK-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N2C(=C3C=C(C=CC3=N2)O)Cl)O |
Computed by PubChem (NCBI)