CAS 193-43-1 appears in our catalog under these names: Indeno[1,2,3-cd]fluoranthene, 98%, Indeno(1,2,3-cd)fluoranthene, Indeno(1,2,3-c,d)fluoranthene 10 µg/mL in Acetonitrile, Indeno(1,2,3-c,d)fluoranthene 10 µg/mL in Cyclohexane, 91208, Indeno[1,2,3-cd]fluoranthene (pur. Offered by: Chemat Brand, TRC, Dr. Ehrenstorfer, Sigma-Aldrich. Available pack sizes: on request, 50mg, 10ml, 20MG.
Hexacyclo[9.9.2.02,7.08,21.012,17.018,22]docosa-1,3,5,7,9,11,13,15,17,19,21-undecaene (CAS 193-43-1) is a chemical compound with the molecular formula C22H12 and a molecular weight of 276.3 g/mol. IUPAC name: hexacyclo[9.9.2.02,7.08,21.012,17.018,22]docosa-1,3,5,7,9,11,13,15,17,19,21-undecaene. InChIKey: XAKRHFYJDSMEMI-UHFFFAOYSA-N.
| Molecular formula | C22H12 |
|---|---|
| Molecular weight | 276.3 g/mol |
| IUPAC name | hexacyclo[9.9.2.02,7.08,21.012,17.018,22]docosa-1,3,5,7,9,11,13,15,17,19,21-undecaene |
| InChIKey | XAKRHFYJDSMEMI-UHFFFAOYSA-N |
| SMILES | C1=CC2=C3C=CC4=C5C=CC=CC5=C6C4=C3C(=C2C=C1)C=C6 |
Computed by PubChem (NCBI)