cas: 5695-13-6 — see every product listed under this CAS number, including other names
Indeno[1,2-b]fluorene-6,12-dione 97% (CAS 5695-13-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A858259-250mg |
| cas | 5695-13-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 220.19 Pln | |
| Ambeed | 1g | 381.50 Pln | |
| Ambeed | 5g | 1327.12 Pln | |
| Ambeed | 10g | 2267.19 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A858259 |
Indeno[1,2-b]fluorene-6,12-dione (CAS 5695-13-6) is a chemical compound with the molecular formula C20H10O2 and a molecular weight of 282.3 g/mol. IUPAC name: indeno[1,2-b]fluorene-6,12-dione. InChIKey: AAUHGKXJBZEARK-UHFFFAOYSA-N.
| Molecular formula | C20H10O2 |
|---|---|
| Molecular weight | 282.3 g/mol |
| IUPAC name | indeno[1,2-b]fluorene-6,12-dione |
| InChIKey | AAUHGKXJBZEARK-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=CC4=C(C=C3C2=O)C5=CC=CC=C5C4=O |
Computed by PubChem (NCBI)