Products 5695-13-6
CAS 5695-13-6 appears in our catalog under these names: Indeno[1,2-b]fluorene-6,12-dione, 97%, Indeno(1,2-b)fluorene-6,12-dione, 95-<97%, Indeno(1,2-b)fluorene-6,12-dione, ≥97-<99%, Indeno(1,2-b)fluorene-6,12-dione, 97%, Indeno[1,2-b]fluorene-6,12-dione, 97%, 97%. Offered by: Combi-blocks, Hoffman Fine Chemicals, AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 1g, 50g, 100g, 200g, 300g, 400g.
Indeno[1,2-b]fluorene-6,12-dione (CAS 5695-13-6) is a chemical compound with the molecular formula C20H10O2 and a molecular weight of 282.3 g/mol. IUPAC name: indeno[1,2-b]fluorene-6,12-dione. InChIKey: AAUHGKXJBZEARK-UHFFFAOYSA-N.
| Molecular formula | C20H10O2 |
|---|---|
| Molecular weight | 282.3 g/mol |
| IUPAC name | indeno[1,2-b]fluorene-6,12-dione |
| InChIKey | AAUHGKXJBZEARK-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=CC4=C(C=C3C2=O)C5=CC=CC=C5C4=O |
Computed by PubChem (NCBI)