cas: 5695-13-6 — see every product listed under this CAS number, including other names
Indeno(1,2-b)fluorene-6,12-dione, ≥97-<99% (CAS 5695-13-6) is a chemical reagent available from Chemat. Available pack sizes: 50g, 100g, 200g, 300g, 400g, 500g. Offered by: Hoffman Fine Chemicals.
| brand | Hoffman Fine Chemicals |
|---|---|
| catalog number | HFC654-97-99-50g |
| cas | 5695-13-6 |
| size | 50g |
| availability | 3-4 tygodnie|3-4 weeks |
| brand | size | price | |
|---|---|---|---|
| Hoffman Fine Chemicals | 50g | 5667.20 Pln | |
| Hoffman Fine Chemicals | 100g | 8882.72 Pln | |
| Hoffman Fine Chemicals | 200g | 14025.00 Pln | |
| Hoffman Fine Chemicals | 300g | 16774.78 Pln | |
| Hoffman Fine Chemicals | 400g | 18969.50 Pln | |
| Hoffman Fine Chemicals | 500g | 20137.04 Pln |
| purity | ≥97-<99% |
|---|---|
| category | Chemicals |
| delivery time | 3-4 weeks |
Indeno[1,2-b]fluorene-6,12-dione (CAS 5695-13-6) is a chemical compound with the molecular formula C20H10O2 and a molecular weight of 282.3 g/mol. IUPAC name: indeno[1,2-b]fluorene-6,12-dione. InChIKey: AAUHGKXJBZEARK-UHFFFAOYSA-N.
| Molecular formula | C20H10O2 |
|---|---|
| Molecular weight | 282.3 g/mol |
| IUPAC name | indeno[1,2-b]fluorene-6,12-dione |
| InChIKey | AAUHGKXJBZEARK-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=CC4=C(C=C3C2=O)C5=CC=CC=C5C4=O |
Computed by PubChem (NCBI)