cas: 2338-19-4 — see every product listed under this CAS number, including other names
Indole-3-acetic acid potassium salt, 98% (CAS 2338-19-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Thermo Scientific (Acros).
| brand | Thermo Scientific (Acros) |
|---|---|
| catalog number | 470280010 |
| cas | 2338-19-4 |
| size | 1g |
| availability | availability |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific (Acros) | 1g | 114.03 Pln | |
| Thermo Scientific (Acros) | 5g | 320.72 Pln | |
| Thermo Scientific (Acros) | 25g | 846.35 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 98% |
Potassium 2-(1H-indol-3-yl)acetate (CAS 2338-19-4) is a chemical compound with the molecular formula C10H8KNO2 and a molecular weight of 213.27 g/mol. IUPAC name: potassium 2-(1H-indol-3-yl)acetate. InChIKey: MLWMEUAQPRACHM-UHFFFAOYSA-M.
| Molecular formula | C10H8KNO2 |
|---|---|
| Molecular weight | 213.27 g/mol |
| IUPAC name | potassium 2-(1H-indol-3-yl)acetate |
| InChIKey | MLWMEUAQPRACHM-UHFFFAOYSA-M |
| SMILES | C1=CC=C2C(=C1)C(=CN2)CC(=O)[O-].[K+] |
Computed by PubChem (NCBI)