cas: 2338-19-4 — see every product listed under this CAS number, including other names
Potassium 3-Indoleacetate, >98.0%(HPLC)(N) (CAS 2338-19-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 25g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | I0023-1G |
| cas | 2338-19-4 |
| size | 1g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 1g | 98.68 Pln | |
| TCI | 25g | 851.02 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(HPLC)(N) |
Potassium 2-(1H-indol-3-yl)acetate (CAS 2338-19-4) is a chemical compound with the molecular formula C10H8KNO2 and a molecular weight of 213.27 g/mol. IUPAC name: potassium 2-(1H-indol-3-yl)acetate. InChIKey: MLWMEUAQPRACHM-UHFFFAOYSA-M.
| Molecular formula | C10H8KNO2 |
|---|---|
| Molecular weight | 213.27 g/mol |
| IUPAC name | potassium 2-(1H-indol-3-yl)acetate |
| InChIKey | MLWMEUAQPRACHM-UHFFFAOYSA-M |
| SMILES | C1=CC=C2C(=C1)C(=CN2)CC(=O)[O-].[K+] |
Computed by PubChem (NCBI)