CAS 2338-19-4 appears in our catalog under these names: Potassium 3-indoleacetate, 97%, Potassium 3–indoleacetate, 3-Indoleacetic acid potassium salt, Potassium 3-Indoleacetate, >98.0%(HPLC)(N), Indole-3-acetic acid potassium salt, 98%. Offered by: Combi-blocks, GLPBio, Biosynth, TCI, Thermo Scientific (Acros). Available pack sizes: 25g, 100g, 500g, 1g, 5g, 250g, 1000g, 5000g.
Potassium 2-(1H-indol-3-yl)acetate (CAS 2338-19-4) is a chemical compound with the molecular formula C10H8KNO2 and a molecular weight of 213.27 g/mol. IUPAC name: potassium 2-(1H-indol-3-yl)acetate. InChIKey: MLWMEUAQPRACHM-UHFFFAOYSA-M.
| Molecular formula | C10H8KNO2 |
|---|---|
| Molecular weight | 213.27 g/mol |
| IUPAC name | potassium 2-(1H-indol-3-yl)acetate |
| InChIKey | MLWMEUAQPRACHM-UHFFFAOYSA-M |
| SMILES | C1=CC=C2C(=C1)C(=CN2)CC(=O)[O-].[K+] |
Computed by PubChem (NCBI)