cas: 1394953-96-8 — see every product listed under this CAS number, including other names
Isopropyl 5-isopropoxynicotinate, ≥95%, ≥95% (CAS 1394953-96-8) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch132Q50-1g |
| cas | 1394953-96-8 |
| size | 1g |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 3275.60 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
Propan-2-yl 5-propan-2-yloxypyridine-3-carboxylate (CAS 1394953-96-8) is a chemical compound with the molecular formula C12H17NO3 and a molecular weight of 223.27 g/mol. IUPAC name: propan-2-yl 5-propan-2-yloxypyridine-3-carboxylate. InChIKey: APDOADAQOCEMIG-UHFFFAOYSA-N.
| Molecular formula | C12H17NO3 |
|---|---|
| Molecular weight | 223.27 g/mol |
| IUPAC name | propan-2-yl 5-propan-2-yloxypyridine-3-carboxylate |
| InChIKey | APDOADAQOCEMIG-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=CN=CC(=C1)C(=O)OC(C)C |
Computed by PubChem (NCBI)