Products 937820-89-8
CAS 937820-89-8 appears in our catalog under these names: JC2-11/ 98.6% (existing batch purity), JC2–11, JC2-11 98%, JC2-11, JC2-11, 98.03%. Offered by: TargetMol, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 250mg.
(E)-1-(3-fluoro-4-methoxyphenyl)-3-(4-hydroxy-3-methoxyphenyl)prop-2-en-1-one (CAS 937820-89-8) is a chemical compound with the molecular formula C17H15FO4 and a molecular weight of 302.30 g/mol. IUPAC name: (E)-1-(3-fluoro-4-methoxyphenyl)-3-(4-hydroxy-3-methoxyphenyl)prop-2-en-1-one. InChIKey: YYAIFDXWRNNHAW-ZZXKWVIFSA-N.
| Molecular formula | C17H15FO4 |
|---|---|
| Molecular weight | 302.30 g/mol |
| IUPAC name | (E)-1-(3-fluoro-4-methoxyphenyl)-3-(4-hydroxy-3-methoxyphenyl)prop-2-en-1-one |
| InChIKey | YYAIFDXWRNNHAW-ZZXKWVIFSA-N |
| SMILES | COC1=C(C=C(C=C1)C(=O)/C=C/C2=CC(=C(C=C2)O)OC)F |
Computed by PubChem (NCBI)