Products 2234284-82-1
CAS 2234284-82-1 appears in our catalog under these names: cpd.5 of 2234271-86-2, JI130/ 99.01% (existing batch purity), JI130, JI130, 99.41%, cpd.5 of 2234271-86-2/ 98.82% (existing batch purity). Offered by: Chemat, TargetMol, GLPBio, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 500mg.
(E)-3-(7-methoxy-1H-indol-3-yl)-N-[2-(2-prop-2-enoxyphenyl)ethyl]prop-2-enamide (CAS 2234271-86-2) is a chemical compound with the molecular formula C23H24N2O3 and a molecular weight of 376.4 g/mol. IUPAC name: (E)-3-(7-methoxy-1H-indol-3-yl)-N-[2-(2-prop-2-enoxyphenyl)ethyl]prop-2-enamide. InChIKey: BNTYDBBGNPFECO-VAWYXSNFSA-N.
| Molecular formula | C23H24N2O3 |
|---|---|
| Molecular weight | 376.4 g/mol |
| IUPAC name | (E)-3-(7-methoxy-1H-indol-3-yl)-N-[2-(2-prop-2-enoxyphenyl)ethyl]prop-2-enamide |
| InChIKey | BNTYDBBGNPFECO-VAWYXSNFSA-N |
| SMILES | COC1=CC=CC2=C1NC=C2/C=C/C(=O)NCCC3=CC=CC=C3OCC=C |
Computed by PubChem (NCBI)