Products 1680193-80-9
CAS 1680193-80-9 appears in our catalog under these names: JZP-361/ 99.41% (existing batch purity), JZP 361, JZP 361, JZP-361, 99.82% ,, 99.82% ,, JZP-361, 99.72%. Offered by: TargetMol, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 1mg, 200mg.
[4-(13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)piperidin-1-yl]-(1,2,4-triazol-1-yl)methanone (CAS 1680193-80-9) is a chemical compound with the molecular formula C22H20ClN5O and a molecular weight of 405.9 g/mol. IUPAC name: [4-(13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)piperidin-1-yl]-(1,2,4-triazol-1-yl)methanone. InChIKey: GAVZCGTYRWKKDV-UHFFFAOYSA-N.
| Molecular formula | C22H20ClN5O |
|---|---|
| Molecular weight | 405.9 g/mol |
| IUPAC name | [4-(13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)piperidin-1-yl]-(1,2,4-triazol-1-yl)methanone |
| InChIKey | GAVZCGTYRWKKDV-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C=CC(=C2)Cl)C(=C3CCN(CC3)C(=O)N4C=NC=N4)C5=C1C=CC=N5 |
Computed by PubChem (NCBI)
Synonyms:
orb1700261