cas: 19473-49-5 — see every product listed under this CAS number, including other names
L–Glutamic acid monopotassium salt (CAS 19473-49-5) is a chemical reagent available from Chemat. Available pack sizes: 100g, 1g, 25g, 500mg, 5g. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GF10324-100g |
| cas | 19473-49-5 |
| size | 100g |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 100g | 7425.89 Pln | |
| GLPBio | 1g | 812.34 Pln | |
| GLPBio | 25g | 3213.44 Pln | |
| GLPBio | 500mg | 667.25 Pln | |
| GLPBio | 5g | 1514.42 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
Potassium;(4S)-4-amino-5-hydroxy-5-oxopentanoate;hydrate (CAS 19473-49-5) is a chemical compound with the molecular formula C5H10KNO5 and a molecular weight of 203.23 g/mol. IUPAC name: potassium;(4S)-4-amino-5-hydroxy-5-oxopentanoate;hydrate. InChIKey: XIBUKSQTWSKJMQ-QTNFYWBSSA-M.
| Molecular formula | C5H10KNO5 |
|---|---|
| Molecular weight | 203.23 g/mol |
| IUPAC name | potassium;(4S)-4-amino-5-hydroxy-5-oxopentanoate;hydrate |
| InChIKey | XIBUKSQTWSKJMQ-QTNFYWBSSA-M |
| SMILES | C(CC(=O)[O-])[C@@H](C(=O)O)N.O.[K+] |
Computed by PubChem (NCBI)