cas: 19473-49-5 — see every product listed under this CAS number, including other names
Monopotassium glutamate (CAS 19473-49-5) is a chemical reagent available from Chemat. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg. Offered by: TargetMol.
| brand | TargetMol |
|---|---|
| catalog number | T20365-5mg |
| cas | 19473-49-5 |
| size | 5mg |
| brand | size | price | |
|---|---|---|---|
| TargetMol | 5mg | 511.92 Pln | |
| TargetMol | 10mg | 638.26 Pln | |
| TargetMol | 25mg | 917.20 Pln | |
| TargetMol | 50mg | 1249.24 Pln | |
| TargetMol | 100mg | 1760.73 Pln |
| purity | No data |
|---|---|
| delivery time | approx. 15 days |
Potassium;(4S)-4-amino-5-hydroxy-5-oxopentanoate;hydrate (CAS 19473-49-5) is a chemical compound with the molecular formula C5H10KNO5 and a molecular weight of 203.23 g/mol. IUPAC name: potassium;(4S)-4-amino-5-hydroxy-5-oxopentanoate;hydrate. InChIKey: XIBUKSQTWSKJMQ-QTNFYWBSSA-M.
| Molecular formula | C5H10KNO5 |
|---|---|
| Molecular weight | 203.23 g/mol |
| IUPAC name | potassium;(4S)-4-amino-5-hydroxy-5-oxopentanoate;hydrate |
| InChIKey | XIBUKSQTWSKJMQ-QTNFYWBSSA-M |
| SMILES | C(CC(=O)[O-])[C@@H](C(=O)O)N.O.[K+] |
Computed by PubChem (NCBI)