cas: 193693-68-4 — see every product listed under this CAS number, including other names
L-1-Fmoc-Nipecotic acid, 95% (CAS 193693-68-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F041311-1G |
| cas | 193693-68-4 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 164.54 Pln | |
| Fluorochem | 5g | 388.42 Pln | |
| Fluorochem | 10g | 726.85 Pln | |
| Fluorochem | 25g | 1716.08 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
(3S)-1-(9H-fluoren-9-ylmethoxycarbonyl)piperidine-3-carboxylic acid (CAS 193693-68-4) is a chemical compound with the molecular formula C21H21NO4 and a molecular weight of 351.4 g/mol. IUPAC name: (3S)-1-(9H-fluoren-9-ylmethoxycarbonyl)piperidine-3-carboxylic acid. InChIKey: FINXGQXNIBNREL-AWEZNQCLSA-N.
| Molecular formula | C21H21NO4 |
|---|---|
| Molecular weight | 351.4 g/mol |
| IUPAC name | (3S)-1-(9H-fluoren-9-ylmethoxycarbonyl)piperidine-3-carboxylic acid |
| InChIKey | FINXGQXNIBNREL-AWEZNQCLSA-N |
| SMILES | C1C[C@@H](CN(C1)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)C(=O)O |
Computed by PubChem (NCBI)