Products 183298-68-2
CAS 183298-68-2 appears in our catalog under these names: L-161240/ 97.14% (existing batch purity), L 161,240, L-161240. Offered by: TargetMol, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 1 mg.
(4R)-2-(3,4-dimethoxy-5-propylphenyl)-N-hydroxy-4,5-dihydro-1,3-oxazole-4-carboxamide (CAS 183298-68-2) is a chemical compound with the molecular formula C15H20N2O5 and a molecular weight of 308.33 g/mol. IUPAC name: (4R)-2-(3,4-dimethoxy-5-propylphenyl)-N-hydroxy-4,5-dihydro-1,3-oxazole-4-carboxamide. InChIKey: DGGKRIGJIQRXQD-LLVKDONJSA-N.
| Molecular formula | C15H20N2O5 |
|---|---|
| Molecular weight | 308.33 g/mol |
| IUPAC name | (4R)-2-(3,4-dimethoxy-5-propylphenyl)-N-hydroxy-4,5-dihydro-1,3-oxazole-4-carboxamide |
| InChIKey | DGGKRIGJIQRXQD-LLVKDONJSA-N |
| SMILES | CCCC1=C(C(=CC(=C1)C2=N[C@H](CO2)C(=O)NO)OC)OC |
Computed by PubChem (NCBI)