cas: 13485-59-1 — see every product listed under this CAS number, including other names
L-Alanyl-L-proline, 97%, 97% (CAS 13485-59-1) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 75g, 100g, 500g, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114CIM-5g |
| cas | 13485-59-1 |
| size | 5g |
| availability | 1000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 74.00 Pln | |
| Chemat | 10g | 78.80 Pln | |
| Chemat | 25g | 83.60 Pln | |
| Chemat | 75g | 136.40 Pln | |
| Chemat | 100g | 141.20 Pln | |
| Chemat | 500g | 513.60 Pln | |
| Chemat | 250mg | 69.20 Pln | |
| Chemat | 1g | 74.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Ala-Pro is a dipeptide composed of L-alanine and L-proline joined by a peptide linkage. It has a role as a metabolite. It is functionally related to a L-alanine and a L-proline. It is a tautomer of an Ala-Pro zwitterion.
Source: ChEBI
| Molecular formula | C8H14N2O3 |
|---|---|
| Molecular weight | 186.21 g/mol |
| IUPAC name | (2S)-1-[(2S)-2-aminopropanoyl]pyrrolidine-2-carboxylic acid |
| InChIKey | WPWUFUBLGADILS-WDSKDSINSA-N |
| SMILES | C[C@@H](C(=O)N1CCC[C@H]1C(=O)O)N |
Computed by PubChem (NCBI)