Products 1260879-99-9
CAS 1260879-99-9 appears in our catalog under these names: 2-(3,5-Dimethyl-1h-pyrazol-1-yl)propanoic acid hydrate, 95%, 2-(3,5-Dimethyl-1H-pyrazol-1-yl)propanoic acid hydrate, 97%. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 5g, 250mg, 1g.
2-(3,5-dimethylpyrazol-1-yl)propanoic acid;hydrate (CAS 1260879-99-9) is a chemical compound with the molecular formula C8H14N2O3 and a molecular weight of 186.21 g/mol. IUPAC name: 2-(3,5-dimethylpyrazol-1-yl)propanoic acid;hydrate. InChIKey: BRERMJSZWYNIDQ-UHFFFAOYSA-N.
| Molecular formula | C8H14N2O3 |
|---|---|
| Molecular weight | 186.21 g/mol |
| IUPAC name | 2-(3,5-dimethylpyrazol-1-yl)propanoic acid;hydrate |
| InChIKey | BRERMJSZWYNIDQ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NN1C(C)C(=O)O)C.O |
Computed by PubChem (NCBI)