CAS 61430-12-4 appears in our catalog under these names: H-D-Ala-pro-oh hydrochloride, 95%, (S)-1-((R)-2-Aminopropanoyl)pyrrolidine-2-carboxylic acid, 97%. Offered by: Combi-blocks, Chemat Brand. Available pack sizes: 25g, 1g, 5g, on request.
(2S)-1-[(2R)-2-aminopropanoyl]pyrrolidine-2-carboxylic acid (CAS 61430-12-4) is a chemical compound with the molecular formula C8H14N2O3 and a molecular weight of 186.21 g/mol. IUPAC name: (2S)-1-[(2R)-2-aminopropanoyl]pyrrolidine-2-carboxylic acid. InChIKey: WPWUFUBLGADILS-RITPCOANSA-N.
| Molecular formula | C8H14N2O3 |
|---|---|
| Molecular weight | 186.21 g/mol |
| IUPAC name | (2S)-1-[(2R)-2-aminopropanoyl]pyrrolidine-2-carboxylic acid |
| InChIKey | WPWUFUBLGADILS-RITPCOANSA-N |
| SMILES | C[C@H](C(=O)N1CCC[C@H]1C(=O)O)N |
Computed by PubChem (NCBI)