cas: 201419-16-1 — see every product listed under this CAS number, including other names
L-Homocysteine,N-[(1,1-dimethylethoxy)carbonyl]-S-(triphenylmethyl)-, 98%, 98% (CAS 201419-16-1) is a chemical reagent available from Chemat. Available pack sizes: 50g, 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113DEG-50g |
| cas | 201419-16-1 |
| size | 50g |
| availability | 100g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50g | 5162.00 Pln | |
| Chemat | 100mg | 83.60 Pln | |
| Chemat | 250mg | 107.60 Pln | |
| Chemat | 1g | 213.20 Pln | |
| Chemat | 5g | 750.80 Pln | |
| Chemat | 10g | 1302.80 Pln | |
| Chemat | 25g | 2819.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-tritylsulfanylbutanoic acid (CAS 201419-16-1) is a chemical compound with the molecular formula C28H31NO4S and a molecular weight of 477.6 g/mol. IUPAC name: (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-tritylsulfanylbutanoic acid. InChIKey: YBAYCOKLWMVUSV-DEOSSOPVSA-N.
| Molecular formula | C28H31NO4S |
|---|---|
| Molecular weight | 477.6 g/mol |
| IUPAC name | (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-tritylsulfanylbutanoic acid |
| InChIKey | YBAYCOKLWMVUSV-DEOSSOPVSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCSC(C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3)C(=O)O |
Computed by PubChem (NCBI)