cas: 201419-16-1 — see every product listed under this CAS number, including other names
Boc-L-HomoCys(Trt)-OH, 95% (CAS 201419-16-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F300152-1G |
| cas | 201419-16-1 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 284.29 Pln | |
| Fluorochem | 5g | 1127.75 Pln | |
| Fluorochem | 10g | 2080.54 Pln | |
| Fluorochem | 25g | 4793.12 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-tritylsulfanylbutanoic acid (CAS 201419-16-1) is a chemical compound with the molecular formula C28H31NO4S and a molecular weight of 477.6 g/mol. IUPAC name: (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-tritylsulfanylbutanoic acid. InChIKey: YBAYCOKLWMVUSV-DEOSSOPVSA-N.
| Molecular formula | C28H31NO4S |
|---|---|
| Molecular weight | 477.6 g/mol |
| IUPAC name | (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-tritylsulfanylbutanoic acid |
| InChIKey | YBAYCOKLWMVUSV-DEOSSOPVSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCSC(C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3)C(=O)O |
Computed by PubChem (NCBI)