cas: 22430-23-5 — see every product listed under this CAS number, including other names
L-Mannono-1,4-lactone, 95%, 95% (CAS 22430-23-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11JKK8-100mg |
| cas | 22430-23-5 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 357.20 Pln | |
| Chemat | 250mg | 530.00 Pln | |
| Chemat | 1g | 1370.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(3R,4S,5S)-5-[(1S)-1,2-dihydroxyethyl]-3,4-dihydroxyoxolan-2-one (CAS 22430-23-5) is a chemical compound with the molecular formula C6H10O6 and a molecular weight of 178.14 g/mol. IUPAC name: (3R,4S,5S)-5-[(1S)-1,2-dihydroxyethyl]-3,4-dihydroxyoxolan-2-one. InChIKey: SXZYCXMUPBBULW-KLVWXMOXSA-N.
| Molecular formula | C6H10O6 |
|---|---|
| Molecular weight | 178.14 g/mol |
| IUPAC name | (3R,4S,5S)-5-[(1S)-1,2-dihydroxyethyl]-3,4-dihydroxyoxolan-2-one |
| InChIKey | SXZYCXMUPBBULW-KLVWXMOXSA-N |
| SMILES | C([C@@H]([C@H]1[C@H]([C@H](C(=O)O1)O)O)O)O |
Computed by PubChem (NCBI)