cas: 18555-65-2 — see every product listed under this CAS number, including other names
L-Ribose, 5-deoxy- (CAS 18555-65-2) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11AOKY-50mg |
| cas | 18555-65-2 |
| size | 50mg |
| availability | 0.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 333.20 Pln | |
| Chemat | 250mg | 1154.00 Pln |
| delivery time | 3 weeks |
|---|
(2S,3S,4S)-2,3,4-trihydroxypentanal (CAS 18555-65-2) is a chemical compound with the molecular formula C5H10O4 and a molecular weight of 134.13 g/mol. IUPAC name: (2S,3S,4S)-2,3,4-trihydroxypentanal. InChIKey: WDRISBUVHBMJEF-LMVFSUKVSA-N.
| Molecular formula | C5H10O4 |
|---|---|
| Molecular weight | 134.13 g/mol |
| IUPAC name | (2S,3S,4S)-2,3,4-trihydroxypentanal |
| InChIKey | WDRISBUVHBMJEF-LMVFSUKVSA-N |
| SMILES | C[C@@H]([C@@H]([C@@H](C=O)O)O)O |
Computed by PubChem (NCBI)