CAS 9001-62-1 appears in our catalog under these names: LIPASE FROM MUCOR MIEHEI, APPROX. 1 U/MG, Lipase, Lipase from Candida antarctica, Lipase Y 01, Immobilized lipase. Offered by: Sigma-Aldrich, Biosynth, TCI, MedChemExpress, Roth. Available pack sizes: 100MG, 50g, 25g, 0,5g, 100g, 2g, 0,25g, 250g.
Sodium 4-(pyridin-2-yldiazenyl)benzene-1,3-diol (CAS 9001-62-1) is a chemical compound with the molecular formula C11H9N3NaO2+ and a molecular weight of 238.20 g/mol. IUPAC name: sodium 4-(pyridin-2-yldiazenyl)benzene-1,3-diol. InChIKey: KZRPHCQLJZXMJV-UHFFFAOYSA-N.
| Molecular formula | C11H9N3NaO2+ |
|---|---|
| Molecular weight | 238.20 g/mol |
| IUPAC name | sodium 4-(pyridin-2-yldiazenyl)benzene-1,3-diol |
| InChIKey | KZRPHCQLJZXMJV-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)N=NC2=C(C=C(C=C2)O)O.[Na+] |
Computed by PubChem (NCBI)