Products 955037-42-0
CAS 955037-42-0 appears in our catalog under these names: LJP-1586 HCl/ 99.4% (existing batch purity), LJP 1586, LJP 1586. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 1 mg.
(Z)-3-fluoro-2-[(4-methoxyphenyl)methyl]prop-2-en-1-amine;hydrochloride (CAS 955037-42-0) is a chemical compound with the molecular formula C11H15ClFNO and a molecular weight of 231.69 g/mol. IUPAC name: (Z)-3-fluoro-2-[(4-methoxyphenyl)methyl]prop-2-en-1-amine;hydrochloride. InChIKey: GNDHRDJFGYCWER-VEZAGKLZSA-N.
| Molecular formula | C11H15ClFNO |
|---|---|
| Molecular weight | 231.69 g/mol |
| IUPAC name | (Z)-3-fluoro-2-[(4-methoxyphenyl)methyl]prop-2-en-1-amine;hydrochloride |
| InChIKey | GNDHRDJFGYCWER-VEZAGKLZSA-N |
| SMILES | COC1=CC=C(C=C1)C/C(=C/F)/CN.Cl |
Computed by PubChem (NCBI)