cas: 37988-18-4 — see every product listed under this CAS number, including other names
LM22A-4 99% (CAS 37988-18-4) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A537524-1mg |
| cas | 37988-18-4 |
| size | 1mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1mg | 192.38 Pln | |
| Ambeed | 5mg | 248.00 Pln | |
| Ambeed | 10mg | 381.50 Pln | |
| Ambeed | 25mg | 737.50 Pln | |
| Ambeed | 50mg | 1227.00 Pln | |
| Ambeed | 100mg | 2094.75 Pln | |
| Ambeed | 250mg | 3034.81 Pln | |
| Ambeed | 1g | 3924.81 Pln |
| purity | 99% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A537524 |
1-N,3-N,5-N-tris(2-hydroxyethyl)benzene-1,3,5-tricarboxamide (CAS 37988-18-4) is a chemical compound with the molecular formula C15H21N3O6 and a molecular weight of 339.34 g/mol. IUPAC name: 1-N,3-N,5-N-tris(2-hydroxyethyl)benzene-1,3,5-tricarboxamide. InChIKey: RGWJKANXFYJKHN-UHFFFAOYSA-N.
| Molecular formula | C15H21N3O6 |
|---|---|
| Molecular weight | 339.34 g/mol |
| IUPAC name | 1-N,3-N,5-N-tris(2-hydroxyethyl)benzene-1,3,5-tricarboxamide |
| InChIKey | RGWJKANXFYJKHN-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1C(=O)NCCO)C(=O)NCCO)C(=O)NCCO |
Computed by PubChem (NCBI)