CAS 509150-43-0 is the registry number for Imidodicarbonic acid, 2-(5-nitro-2-pyridinyl)-, 1,3-bis(1,1-dimethylethyl) ester, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 10g, 1g, 5g.
Tert-butyl N-[(2-methylpropan-2-yl)oxycarbonyl]-N-(5-nitro-2-pyridinyl)carbamate (CAS 509150-43-0) is a chemical compound with the molecular formula C15H21N3O6 and a molecular weight of 339.34 g/mol. IUPAC name: tert-butyl N-[(2-methylpropan-2-yl)oxycarbonyl]-N-(5-nitro-2-pyridinyl)carbamate. InChIKey: VENJSTPMPDHHKG-UHFFFAOYSA-N.
| Molecular formula | C15H21N3O6 |
|---|---|
| Molecular weight | 339.34 g/mol |
| IUPAC name | tert-butyl N-[(2-methylpropan-2-yl)oxycarbonyl]-N-(5-nitro-2-pyridinyl)carbamate |
| InChIKey | VENJSTPMPDHHKG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N(C1=NC=C(C=C1)[N+](=O)[O-])C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)