CAS 861453-16-9 is the registry number for Gefitinib Impurity 47. Offered by: Chemat Brand. Available pack sizes: on request.
4-methoxy-5-(3-morpholin-4-ylpropoxy)-2-nitrobenzamide (CAS 861453-16-9) is a chemical compound with the molecular formula C15H21N3O6 and a molecular weight of 339.34 g/mol. IUPAC name: 4-methoxy-5-(3-morpholin-4-ylpropoxy)-2-nitrobenzamide. InChIKey: CZNVOBRARXZUEA-UHFFFAOYSA-N.
| Molecular formula | C15H21N3O6 |
|---|---|
| Molecular weight | 339.34 g/mol |
| IUPAC name | 4-methoxy-5-(3-morpholin-4-ylpropoxy)-2-nitrobenzamide |
| InChIKey | CZNVOBRARXZUEA-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)[N+](=O)[O-])C(=O)N)OCCCN2CCOCC2 |
Computed by PubChem (NCBI)