Products 2189366-77-4
CAS 2189366-77-4 appears in our catalog under these names: LTβR-IN-1/ 99.09% (existing batch purity), LTβR–IN–1, Ltβr-in-1, LTβR-IN-1, LTβR-IN-1, 99.92%. Offered by: TargetMol, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 10 mg.
(2R)-N-(1H-benzimidazol-2-yl)-2-(3-oxo-1H-isoindol-2-yl)propanamide (CAS 2189366-77-4) is a chemical compound with the molecular formula C18H16N4O2 and a molecular weight of 320.3 g/mol. IUPAC name: (2R)-N-(1H-benzimidazol-2-yl)-2-(3-oxo-1H-isoindol-2-yl)propanamide. InChIKey: PWSSISUOJZBZFT-LLVKDONJSA-N.
| Molecular formula | C18H16N4O2 |
|---|---|
| Molecular weight | 320.3 g/mol |
| IUPAC name | (2R)-N-(1H-benzimidazol-2-yl)-2-(3-oxo-1H-isoindol-2-yl)propanamide |
| InChIKey | PWSSISUOJZBZFT-LLVKDONJSA-N |
| SMILES | C[C@H](C(=O)NC1=NC2=CC=CC=C2N1)N3CC4=CC=CC=C4C3=O |
Computed by PubChem (NCBI)