CAS 186543-64-6 appears in our catalog under these names: LY 344864 racemate/ 99.47% (existing batch purity), Ly 344864 racemate, LY 344864 (racemate), LY 344864 (racemate), 98.07%. Offered by: TargetMol, Biosynth, Chemat, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 2mg, 100 mg, 2 mg.
N-[6-(dimethylamino)-6,7,8,9-tetrahydro-5H-carbazol-3-yl]-4-fluorobenzamide (CAS 186543-64-6) is a chemical compound with the molecular formula C21H22FN3O and a molecular weight of 351.4 g/mol. IUPAC name: N-[6-(dimethylamino)-6,7,8,9-tetrahydro-5H-carbazol-3-yl]-4-fluorobenzamide. InChIKey: GKWHICIUSVVNGX-UHFFFAOYSA-N.
| Molecular formula | C21H22FN3O |
|---|---|
| Molecular weight | 351.4 g/mol |
| IUPAC name | N-[6-(dimethylamino)-6,7,8,9-tetrahydro-5H-carbazol-3-yl]-4-fluorobenzamide |
| InChIKey | GKWHICIUSVVNGX-UHFFFAOYSA-N |
| SMILES | CN(C)C1CCC2=C(C1)C3=C(N2)C=CC(=C3)NC(=O)C4=CC=C(C=C4)F |
Computed by PubChem (NCBI)