Products 186544-26-3
CAS 186544-26-3 appears in our catalog under these names: LY 344864/ 98%, LY 344864, LY 344864, ≥98% (HPLC), ≥98% (HPLC), LY 344864, 98.59%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10mM/1mL, 5 mg.
N-[(6R)-6-(dimethylamino)-6,7,8,9-tetrahydro-5H-carbazol-3-yl]-4-fluorobenzamide;hydrochloride (CAS 186544-26-3) is a chemical compound with the molecular formula C21H23ClFN3O and a molecular weight of 387.9 g/mol. IUPAC name: N-[(6R)-6-(dimethylamino)-6,7,8,9-tetrahydro-5H-carbazol-3-yl]-4-fluorobenzamide;hydrochloride. InChIKey: OKUHLSYESBLBCP-PKLMIRHRSA-N.
| Molecular formula | C21H23ClFN3O |
|---|---|
| Molecular weight | 387.9 g/mol |
| IUPAC name | N-[(6R)-6-(dimethylamino)-6,7,8,9-tetrahydro-5H-carbazol-3-yl]-4-fluorobenzamide;hydrochloride |
| InChIKey | OKUHLSYESBLBCP-PKLMIRHRSA-N |
| SMILES | CN(C)[C@@H]1CCC2=C(C1)C3=C(N2)C=CC(=C3)NC(=O)C4=CC=C(C=C4)F.Cl |
Computed by PubChem (NCBI)