CAS 1000308-25-7 appears in our catalog under these names: Landipirdine/ 97.5% (existing batch purity), Landipirdine, Landipirdine, 99.80%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 100 mg, 10 mg.
[(1R)-6-(3-fluorophenyl)sulfonyl-1,2,3,4-tetrahydronaphthalen-1-yl]methylurea (CAS 1000308-25-7) is a chemical compound with the molecular formula C18H19FN2O3S and a molecular weight of 362.4 g/mol. IUPAC name: [(1R)-6-(3-fluorophenyl)sulfonyl-1,2,3,4-tetrahydronaphthalen-1-yl]methylurea. InChIKey: MTTHRRVVGMPYQG-ZDUSSCGKSA-N.
| Molecular formula | C18H19FN2O3S |
|---|---|
| Molecular weight | 362.4 g/mol |
| IUPAC name | [(1R)-6-(3-fluorophenyl)sulfonyl-1,2,3,4-tetrahydronaphthalen-1-yl]methylurea |
| InChIKey | MTTHRRVVGMPYQG-ZDUSSCGKSA-N |
| SMILES | C1C[C@H](C2=C(C1)C=C(C=C2)S(=O)(=O)C3=CC=CC(=C3)F)CNC(=O)N |
Computed by PubChem (NCBI)