cas: 73466-12-3 — see every product listed under this CAS number, including other names
Leukotriene A4 methyl ester (CAS 73466-12-3) is a chemical reagent available from Chemat. Available pack sizes: 25ug, 50ug, 100ug, 25μg, 50μg, 100μg, 50 μg (300.77 μM * 500 μL in Hexane containing 1% triethylamine), 25 μg (300.77 μM * 250 μL in Hexane containing 1% triethylamine). Offered by: TargetMol, GLPBio, Sigma-Aldrich, MedChemExpress.
| brand | TargetMol |
|---|---|
| catalog number | T37616-25ug |
| cas | 73466-12-3 |
| size | 25ug |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| TargetMol | 25ug | 2471.22 Pln | |
| TargetMol | 50ug | 4516.60 Pln | |
| TargetMol | 100ug | 8335.13 Pln | |
| GLPBio | 25μg | 1359.96 Pln | |
| GLPBio | 50μg | 2211.81 Pln | |
| GLPBio | 100μg | 3817.22 Pln | |
| Sigma-Aldrich | 100UG | 1770.00 Pln | |
| MedChemExpress | 50 μg (300.77 μM * 500 μL in Hexane containing 1% triethylamine) | 3013.21 Pln | |
| MedChemExpress | 25 μg (300.77 μM * 250 μL in Hexane containing 1% triethylamine) | 1703.60 Pln |
| purity | No data |
|---|---|
| delivery time | on request |
Methyl 4-[(2S,3S)-3-[(1E,3E,5Z,8Z)-tetradeca-1,3,5,8-tetraenyl]oxiran-2-yl]butanoate (CAS 73466-12-3) is a chemical compound with the molecular formula C21H32O3 and a molecular weight of 332.5 g/mol. IUPAC name: methyl 4-[(2S,3S)-3-[(1E,3E,5Z,8Z)-tetradeca-1,3,5,8-tetraenyl]oxiran-2-yl]butanoate. InChIKey: WTKAVFHPLJFCMZ-NIBLXIPLSA-N.
| Molecular formula | C21H32O3 |
|---|---|
| Molecular weight | 332.5 g/mol |
| IUPAC name | methyl 4-[(2S,3S)-3-[(1E,3E,5Z,8Z)-tetradeca-1,3,5,8-tetraenyl]oxiran-2-yl]butanoate |
| InChIKey | WTKAVFHPLJFCMZ-NIBLXIPLSA-N |
| SMILES | CCCCC/C=C\C/C=C\C=C\C=C\[C@H]1[C@@H](O1)CCCC(=O)OC |
Computed by PubChem (NCBI)