CAS 14364-16-0 appears in our catalog under these names: Steviol methyl ester, 95%, Steviol methyl ester. Offered by: Combi-blocks, Biosynth. Available pack sizes: 100mg, 250mg, 10mg, 5mg, 25mg, 50mg.
Methyl (1R,4S,5R,9S,10R,13S)-13-hydroxy-5,9-dimethyl-14-methylidenetetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylate (CAS 14364-16-0) is a chemical compound with the molecular formula C21H32O3 and a molecular weight of 332.5 g/mol. IUPAC name: methyl (1R,4S,5R,9S,10R,13S)-13-hydroxy-5,9-dimethyl-14-methylidenetetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylate. InChIKey: DMURITDIRWHQPY-IQBUSDBGSA-N.
| Molecular formula | C21H32O3 |
|---|---|
| Molecular weight | 332.5 g/mol |
| IUPAC name | methyl (1R,4S,5R,9S,10R,13S)-13-hydroxy-5,9-dimethyl-14-methylidenetetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylate |
| InChIKey | DMURITDIRWHQPY-IQBUSDBGSA-N |
| SMILES | C[C@@]12CCC[C@@]([C@H]1CC[C@]34[C@H]2CC[C@](C3)(C(=C)C4)O)(C)C(=O)OC |
Computed by PubChem (NCBI)