CAS 73466-12-3 appears in our catalog under these names: (-)-Leukotrienea4methylester, 95%, LTA4 (Leukotriene A4 methyl ester), Leukotriene A4 methyl ester, Leukotriene A4 methyl ester. Offered by: Chemat Brand, TRC, TargetMol, GLPBio, Sigma-Aldrich. Available pack sizes: on request, 5mg, 25ug, 50ug, 100ug, 25μg, 50μg, 100μg.
Methyl 4-[(2S,3S)-3-[(1E,3E,5Z,8Z)-tetradeca-1,3,5,8-tetraenyl]oxiran-2-yl]butanoate (CAS 73466-12-3) is a chemical compound with the molecular formula C21H32O3 and a molecular weight of 332.5 g/mol. IUPAC name: methyl 4-[(2S,3S)-3-[(1E,3E,5Z,8Z)-tetradeca-1,3,5,8-tetraenyl]oxiran-2-yl]butanoate. InChIKey: WTKAVFHPLJFCMZ-NIBLXIPLSA-N.
| Molecular formula | C21H32O3 |
|---|---|
| Molecular weight | 332.5 g/mol |
| IUPAC name | methyl 4-[(2S,3S)-3-[(1E,3E,5Z,8Z)-tetradeca-1,3,5,8-tetraenyl]oxiran-2-yl]butanoate |
| InChIKey | WTKAVFHPLJFCMZ-NIBLXIPLSA-N |
| SMILES | CCCCC/C=C\C/C=C\C=C\C=C\[C@H]1[C@@H](O1)CCCC(=O)OC |
Computed by PubChem (NCBI)