Products 144506-15-0
CAS 144506-15-0 appears in our catalog under these names: Licochalcone D/ 99.73% (existing batch purity), Licochalcone D, Licochalcone D 99%, Licochalcone D, 99.80%. Offered by: TargetMol, Biosynth, Ambeed, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 2mg, 10 mg.
(E)-3-(3,4-dihydroxy-2-methoxyphenyl)-1-[4-hydroxy-3-(3-methylbut-2-enyl)phenyl]prop-2-en-1-one (CAS 144506-15-0) is a chemical compound with the molecular formula C21H22O5 and a molecular weight of 354.4 g/mol. IUPAC name: (E)-3-(3,4-dihydroxy-2-methoxyphenyl)-1-[4-hydroxy-3-(3-methylbut-2-enyl)phenyl]prop-2-en-1-one. InChIKey: RETRVWFVEFCGOK-RMKNXTFCSA-N.
| Molecular formula | C21H22O5 |
|---|---|
| Molecular weight | 354.4 g/mol |
| IUPAC name | (E)-3-(3,4-dihydroxy-2-methoxyphenyl)-1-[4-hydroxy-3-(3-methylbut-2-enyl)phenyl]prop-2-en-1-one |
| InChIKey | RETRVWFVEFCGOK-RMKNXTFCSA-N |
| SMILES | CC(=CCC1=C(C=CC(=C1)C(=O)/C=C/C2=C(C(=C(C=C2)O)O)OC)O)C |
Computed by PubChem (NCBI)