CAS 1392476-33-3 appears in our catalog under these names: Musellarin C, Musellarin C. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, Get quote.
(3R,4aS,10bR)-3-(3-hydroxy-4-methoxyphenyl)-9-methoxy-4a,5,6,10b-tetrahydro-3H-benzo[f]chromen-8-ol (CAS 1392476-33-3) is a chemical compound with the molecular formula C21H22O5 and a molecular weight of 354.4 g/mol. IUPAC name: (3R,4aS,10bR)-3-(3-hydroxy-4-methoxyphenyl)-9-methoxy-4a,5,6,10b-tetrahydro-3H-benzo[f]chromen-8-ol. InChIKey: IVMYSBQSMIOYNB-ZMYBRWDISA-N.
| Molecular formula | C21H22O5 |
|---|---|
| Molecular weight | 354.4 g/mol |
| IUPAC name | (3R,4aS,10bR)-3-(3-hydroxy-4-methoxyphenyl)-9-methoxy-4a,5,6,10b-tetrahydro-3H-benzo[f]chromen-8-ol |
| InChIKey | IVMYSBQSMIOYNB-ZMYBRWDISA-N |
| SMILES | COC1=C(C=C(C=C1)[C@H]2C=C[C@H]3[C@@H](O2)CCC4=CC(=C(C=C34)OC)O)O |
Computed by PubChem (NCBI)