CAS 54383-28-7 appears in our catalog under these names: Lirinidine, Lirinidine/ 98.76% (existing batch purity), Lirinidine, 99.82%. Offered by: GLPBio, TargetMol, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 5 mg, 1 mg.
(6aS)-2-methoxy-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-1-ol (CAS 54383-28-7) is a chemical compound with the molecular formula C18H19NO2 and a molecular weight of 281.3 g/mol. IUPAC name: (6aS)-2-methoxy-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-1-ol. InChIKey: YXVXMURDCBMPRH-AWEZNQCLSA-N.
| Molecular formula | C18H19NO2 |
|---|---|
| Molecular weight | 281.3 g/mol |
| IUPAC name | (6aS)-2-methoxy-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-1-ol |
| InChIKey | YXVXMURDCBMPRH-AWEZNQCLSA-N |
| SMILES | CN1CCC2=CC(=C(C3=C2[C@@H]1CC4=CC=CC=C43)O)OC |
Computed by PubChem (NCBI)