Lithium,quinolin-8-olate, 95-<97% (CAS 25387-93-3) manufactured by Hoffman Fine Chemicals in a 400g pack.
| brand | Hoffman Fine Chemicals |
|---|---|
| catalog number | HFC623-95-97-400g |
| cas | 25387-93-3 |
| size | 400g |
| availability | 3-4 tygodnie|3-4 weeks |
| purity | 95-<97% |
|---|---|
| category | Chemicals |
| delivery time | 3-4 weeks |
Lithium quinolin-8-olate (CAS 25387-93-3) is a chemical compound with the molecular formula C9H6LiNO and a molecular weight of 151.1 g/mol. IUPAC name: lithium quinolin-8-olate. InChIKey: FQHFBFXXYOQXMN-UHFFFAOYSA-M.
| Molecular formula | C9H6LiNO |
|---|---|
| Molecular weight | 151.1 g/mol |
| IUPAC name | lithium quinolin-8-olate |
| InChIKey | FQHFBFXXYOQXMN-UHFFFAOYSA-M |
| SMILES | [Li+].C1=CC2=C(C(=C1)[O-])N=CC=C2 |
Computed by PubChem (NCBI)