CAS 1639933-78-0 appears in our catalog under these names: LolCDE-IN-1/ 99.63% (existing batch purity), LolCDE–IN–1, Lolcde-in-1, 4-(3-(3-((4-Fluorobenzyl)oxy)phenyl)-1H-pyrazol-4-yl)pyridine, 98%, 98%, LolCDE-IN-1, 98.97%. Offered by: TargetMol, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 10mM/1mL.
4-[5-[3-[(4-fluorophenyl)methoxy]phenyl]-1H-pyrazol-4-yl]pyridine (CAS 1639933-78-0) is a chemical compound with the molecular formula C21H16FN3O and a molecular weight of 345.4 g/mol. IUPAC name: 4-[5-[3-[(4-fluorophenyl)methoxy]phenyl]-1H-pyrazol-4-yl]pyridine. InChIKey: DNZHPYAAJMOOPF-UHFFFAOYSA-N.
| Molecular formula | C21H16FN3O |
|---|---|
| Molecular weight | 345.4 g/mol |
| IUPAC name | 4-[5-[3-[(4-fluorophenyl)methoxy]phenyl]-1H-pyrazol-4-yl]pyridine |
| InChIKey | DNZHPYAAJMOOPF-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)OCC2=CC=C(C=C2)F)C3=C(C=NN3)C4=CC=NC=C4 |
Computed by PubChem (NCBI)