Products 120462-45-5
CAS 120462-45-5 appears in our catalog under these names: Lophanthoidin E/ 98%, Lophanthoidin E. Offered by: TargetMol, Biosynth, MedChemExpress, Chemat. Available pack sizes: 1mg, 10mg, 5mg, 25mg, 50mg, 1 mg.
2-(1,9,10-trihydroxy-4b,8,8-trimethyl-3,4-dioxo-5,6,7,8a,9,10-hexahydrophenanthren-2-yl)propyl acetate (CAS 120462-45-5) is a chemical compound with the molecular formula C22H30O7 and a molecular weight of 406.5 g/mol. IUPAC name: 2-(1,9,10-trihydroxy-4b,8,8-trimethyl-3,4-dioxo-5,6,7,8a,9,10-hexahydrophenanthren-2-yl)propyl acetate. InChIKey: NHVNNHGOOVAQDU-UHFFFAOYSA-N.
| Molecular formula | C22H30O7 |
|---|---|
| Molecular weight | 406.5 g/mol |
| IUPAC name | 2-(1,9,10-trihydroxy-4b,8,8-trimethyl-3,4-dioxo-5,6,7,8a,9,10-hexahydrophenanthren-2-yl)propyl acetate |
| InChIKey | NHVNNHGOOVAQDU-UHFFFAOYSA-N |
| SMILES | CC(COC(=O)C)C1=C(C2=C(C(=O)C1=O)C3(CCCC(C3C(C2O)O)(C)C)C)O |
Computed by PubChem (NCBI)
Synonyms:
Lophanthoidin E, orb1297094