CAS 1425511-32-5 appears in our catalog under these names: Luvadaxistat, Luvadaxistat/ 100%, Luvadaxistat 99%, Luvadaxistat, 98.25%. Offered by: GLPBio, TargetMol, Ambeed, Chemat, MedChemExpress. Available pack sizes: 5mg, 1mg, 10mg, 25mg, 50mg, 100mg, 250mg, 200mg.
6-[2-[4-(trifluoromethyl)phenyl]ethyl]-1,2-dihydropyridazine-3,4-dione (CAS 1425511-32-5) is a chemical compound with the molecular formula C13H11F3N2O2 and a molecular weight of 284.23 g/mol. IUPAC name: 6-[2-[4-(trifluoromethyl)phenyl]ethyl]-1,2-dihydropyridazine-3,4-dione. InChIKey: QBQMUMMSYHUDFM-UHFFFAOYSA-N.
| Molecular formula | C13H11F3N2O2 |
|---|---|
| Molecular weight | 284.23 g/mol |
| IUPAC name | 6-[2-[4-(trifluoromethyl)phenyl]ethyl]-1,2-dihydropyridazine-3,4-dione |
| InChIKey | QBQMUMMSYHUDFM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CCC2=CC(=O)C(=O)NN2)C(F)(F)F |
Computed by PubChem (NCBI)